| Drug General Information |
| Drug ID |
D0L6HN
|
| Former ID |
DNC010455
|
| Drug Name |
PHENOL
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Phase 2/3 |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C6H6O
|
| Canonical SMILES |
C1=CC(=C(C=C1Cl)C(C2=C(C=CC(=C2)Cl)O)C(Cl)(Cl)Cl)O
|
| InChI |
1S/C14H9Cl5O2/c15-7-1-3-11(20)9(5-7)13(14(17,18)19)10-6-8(16)2-4-12(10)21/h1-6,13,20-21H
|
| InChIKey |
HDYCPSGGGILQTK-UHFFFAOYSA-N
|
| CAS Number |
CAS 108-95-2
|
| PubChem Compound ID |
|
| SuperDrug ATC ID |
C05BB05; D08AE03; N01BX03; R02AA19
|
| Target and Pathway |
| Target(s) |
Carbonic anhydrase I |
Target Info |
Inhibitor |
[2]
|
|---|
| Carbonic anhydrase IV |
Target Info |
Inhibitor |
[2]
|
| Carbonic anhydrase |
Target Info |
Inhibitor |
[2]
|
| Carbonic anhydrase XII |
Target Info |
Inhibitor |
[2]
|
| Carbonic anhydrase II |
Target Info |
Inhibitor |
[2]
|
| Carbonic anhydrase XIV |
Target Info |
Inhibitor |
[2]
|
| Carbonic anhydrase IX |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Nitrogen metabolismhsa00910:Nitrogen metabolism
|
|
Proximal tubule bicarbonate reclamationhsa00910:Nitrogen metabolismhsa00910:Nitrogen metabolism
|
|
Proximal tubule bicarbonate reclamation
|
|
Collecting duct acid secretion
|
|
Gastric acid secretion
|
|
Pancreatic secretion
|
|
Bile secretionhsa00910:Nitrogen metabolismhsa00910:Nitrogen metabolism
|
|
NetPath Pathway
|
TGF_beta_Receptor Signaling PathwayNetPath_16:IL4 Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
Pathway Interaction Database
|
C-MYB transcription factor networkhif1_tfpathway:HIF-1-alpha transcription factor network
|
|
PathWhiz Pathway
|
Gastric Acid Production
|
|
Reactome
|
Erythrocytes take up carbon dioxide and release oxygen
|
|
Erythrocytes take up oxygen and release carbon dioxide
|
|
Reversible hydration of carbon dioxideR-HSA-1237044:Erythrocytes take up carbon dioxide and release oxygen
|
|
Reversible hydration of carbon dioxideR-HSA-1475029:Reversible hydration of carbon dioxideR-HSA-1237044:Erythrocytes take up carbon dioxide and release oxygen
|
|
Reversible hydration of carbon dioxideR-HSA-1475029:Reversible hydration of carbon dioxideR-HSA-1234158:Regulation of gene expression by Hypoxia-inducible Factor
|
|
Reversible hydration of carbon dioxide
|
|
WikiPathways
|
Reversible Hydration of Carbon Dioxide
|
|
Uptake of Carbon Dioxide and Release of Oxygen by Erythrocytes
|
|
Uptake of Oxygen and Release of Carbon Dioxide by ErythrocytesWP2770:Reversible Hydration of Carbon Dioxide
|
|
miR-targeted genes in muscle cell - TarBase
|
|
miR-targeted genes in leukocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBaseWP2770:Reversible Hydration of Carbon Dioxide
|
|
Uptake of Oxygen and Release of Carbon Dioxide by ErythrocytesWP2770:Reversible Hydration of Carbon DioxideWP2877:Vitamin D Receptor Pathway
|
|
Regulation of Hypoxia-inducible Factor (HIF) by Oxygen
|
| References |
| REF 1 | ClinicalTrials.gov (NCT02527187) Determination of the Sensitivity and Specificity of Prick Test Betula Verrucosa. |
|---|
| REF 2 | Bioorg Med Chem Lett. 2010 Sep 1;20(17):5050-3. Epub 2010 Jul 13.Carbonic anhydrase inhibitors. Antioxidant polyphenols effectively inhibit mammalian isoforms I-XV. |
|---|
