| Drug General Information |
| Drug ID |
D0U7CD
|
| Former ID |
DNC001230
|
| Drug Name |
Roche 28-2653
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C27H24N4O5
|
| Canonical SMILES |
C1CN(CCN1C2=CC=C(C=C2)[N+](=O)[O-])C3(C(=O)CC(=O)NC3=O)<br />C4=CC=C(C=C4)C5=CC=CC=C5
|
| InChI |
1S/C27H24N4O5/c32-24-18-25(33)28-26(34)27(24,21-8-6-20(7-9-21)19-4-2-1-3-5-19)30-16-14-29(15-17-30)22-10-12-23(13-11-22)31(35)36/h1-13H,14-18H2,(H,28,33,34)
|
| InChIKey |
VWJFDSFQMZGQHZ-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
|
| Target and Pathway |
| Target(s) |
72 kDa type IV collagenase |
Target Info |
Inhibitor |
[1]
|
|---|
| MMP-9 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Leukocyte transendothelial migration
|
|
GnRH signaling pathway
|
|
Estrogen signaling pathway
|
|
Pathways in cancer
|
|
Proteoglycans in cancer
|
|
Bladder cancerhsa04668:TNF signaling pathway
|
|
Hepatitis B
|
|
Transcriptional misregulation in cancer
|
|
MicroRNAs in cancer
|
|
Bladder cancer
|
|
NetPath Pathway
|
Leptin Signaling Pathway
|
|
TCR Signaling Pathway
|
|
ID Signaling PathwayNetPath_5:ID Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
TNFalpha Signaling Pathway
|
|
PANTHER Pathway
|
Alzheimer disease-presenilin pathwayP00004:Alzheimer disease-presenilin pathway
|
|
Plasminogen activating cascade
|
|
CCKR signaling map ST
|
|
Pathway Interaction Database
|
LPA receptor mediated events
|
|
Plasma membrane estrogen receptor signaling
|
|
Osteopontin-mediated events
|
|
Validated transcriptional targets of AP1 family members Fra1 and Fra2
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
Direct p53 effectors
|
|
amb2 Integrin signaling
|
|
ATF-2 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Regulation of nuclear beta catenin signaling and target gene transcription
|
|
Syndecan-2-mediated signaling eventslysophospholipid_pathway:LPA receptor mediated events
|
|
Validated targets of C-MYC transcriptional activation
|
|
CXCR4-mediated signaling events
|
|
Syndecan-4-mediated signaling events
|
|
AP-1 transcription factor network
|
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling
|
|
Syndecan-1-mediated signaling events
|
|
FGF signaling pathway
|
|
Reactome
|
Collagen degradation
|
|
Degradation of the extracellular matrix
|
|
Activation of Matrix Metalloproteinases
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
EPH-ephrin mediated repulsion of cellsR-HSA-1442490:Collagen degradation
|
|
Assembly of collagen fibrils and other multimeric structures
|
|
EPH-ephrin mediated repulsion of cells
|
|
WikiPathways
|
Activation of Matrix Metalloproteinases
|
|
AGE/RAGE pathway
|
|
Matrix MetalloproteinasesWP474:Endochondral Ossification
|
|
IL1 and megakaryotyces in obesity
|
|
Mammary gland development pathway - Involution (Stage 4 of 4)
|
|
Degradation of collagen
|
|
Spinal Cord Injury
|
|
TWEAK Signaling Pathway
|
|
Angiogenesis
|
|
Osteopontin Signaling
|
|
Matrix Metalloproteinases
|
| References |
| REF 1 | The new synthetic matrix metalloproteinase inhibitor (Roche 28-2653) reduces tumor growth and prolongs survival in a prostate cancer standard rat model. Oncogene. 2002 Mar 27;21(13):2089-96. |
|---|
