| Drug General Information |
| Drug ID |
D0UN9O
|
| Former ID |
DIB019969
|
| Drug Name |
GTP-14564
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C15H10N2O
|
| InChI |
InChI=1S/C15H10N2O/c1-2-6-10(7-3-1)13-15-14(17-16-13)11-8-4-5-9-12(11)18-15/h1-9H,(H,16,17)
|
| InChIKey |
DZQLVVLATXPWBK-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
4506287, 9941449, 15341863, 24844379, 26758850, 29215517, 36232097, 47424216, 57356238, 71917933, 78719544, 85787171, 89666279, 95535341, 99302685, 103567618, 112220037, 126171093, 127810021, 134964472, 135266752, 135698359, 135783795, 137394095, 140517014, 160854736, 162023265, 163687994, 166678119, 175607411, 178102605, 179236132, 228650806, 241063970, 241375771, 252156290
|
| Target and Pathway |
| Target(s) |
Mast/stem cell growth factor receptor |
Target Info |
Inhibitor |
[1]
|
|---|
| FL cytokine receptor |
Target Info |
Inhibitor |
[1]
|
| Beta platelet-derived growth factor receptor |
Target Info |
Inhibitor |
[1]
|
| mRNA of Colony stimulating factor-1 receptor |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Ras signaling pathway
|
|
Rap1 signaling pathway
|
|
Cytokine-cytokine receptor interaction
|
|
Endocytosis
|
|
PI3K-Akt signaling pathway
|
|
Hematopoietic cell lineage
|
|
Melanogenesis
|
|
Pathways in cancer
|
|
Acute myeloid leukemia
|
|
Central carbon metabolism in cancerhsa04060:Cytokine-cytokine receptor interaction
|
|
Transcriptional misregulation in cancer
|
|
Central carbon metabolism in cancerhsa04010:MAPK signaling pathway
|
|
Calcium signaling pathway
|
|
Focal adhesion
|
|
Gap junction
|
|
Regulation of actin cytoskeleton
|
|
HTLV-I infection
|
|
MicroRNAs in cancer
|
|
Glioma
|
|
Prostate cancer
|
|
Melanoma
|
|
Central carbon metabolism in cancer
|
|
Choline metabolism in cancer
|
|
NetPath Pathway
|
IL3 Signaling Pathway
|
|
IL4 Signaling Pathway
|
|
KitReceptor Signaling PathwayNetPath_11:TCR Signaling Pathway
|
|
Notch Signaling Pathway
|
|
PANTHER Pathway
|
Angiogenesis
|
|
PDGF signaling pathway
|
|
Pathway Interaction Database
|
C-MYB transcription factor network
|
|
Signaling events mediated by Stem cell factor receptor (c-Kit)ptp1bpathway:Signaling events mediated by PTP1B
|
|
Beta3 integrin cell surface interactions
|
|
S1P3 pathway
|
|
Nectin adhesion pathway
|
|
Signaling events mediated by TCPTP
|
|
SHP2 signaling
|
|
S1P1 pathway
|
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling
|
|
PDGFR-beta signaling pathway
|
|
Validated targets of C-MYC transcriptional repression
|
|
PDGF receptor signaling networkptp1bpathway:Signaling events mediated by PTP1B
|
|
Integrins in angiogenesis
|
|
Reactome
|
PIP3 activates AKT signaling
|
|
Regulation of KIT signaling
|
|
Constitutive Signaling by Aberrant PI3K in Cancer
|
|
RAF/MAP kinase cascadeR-HSA-1257604:PIP3 activates AKT signaling
|
|
RAF/MAP kinase cascade
|
|
WikiPathways
|
Kit receptor signaling pathway
|
|
Differentiation Pathway
|
|
Signaling by SCF-KIT
|
|
PIP3 activates AKT signaling
|
|
Cardiac Progenitor Differentiation
|
|
miR-targeted genes in muscle cell - TarBase
|
|
miR-targeted genes in lymphocytes - TarBase
|
|
miR-targeted genes in epithelium - TarBaseWP51:Regulation of Actin Cytoskeleton
|
|
MAPK Signaling Pathway
|
|
Osteoblast Signaling
|
|
Focal Adhesion
|
|
PDGF Pathway
|
|
Signaling Pathways in Glioblastoma
|
|
Signaling by PDGF
|
| References |
| REF 1 | Selective cytotoxic mechanism of GTP-14564, a novel tyrosine kinase inhibitor in leukemia cells expressing a constitutively active Fms-like tyrosine kinase 3 (FLT3). J Biol Chem. 2003 Aug 29;278(35):32892-8. Epub 2003 Jun 18. |
|---|
