| Drug General Information |
| Drug ID |
D05GKC
|
| Former ID |
DNC011349
|
| Drug Name |
ZEARALANONE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C18H24O5
|
| Canonical SMILES |
CC1CCCC(=O)CCCCCC2=CC(=CC(=C2C(=O)O1)O)O
|
| InChI |
1S/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h10-12,20-21H,2-9H2,1H3/t12-/m0/s1
|
| InChIKey |
APJDQUGPCJRQRJ-LBPRGKRZSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Heat shock protein HSP 90 |
Target Info |
Inhibitor |
[1]
|
|---|
| Heat shock protein HSP90 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Protein processing in endoplasmic reticulum
|
|
PI3K-Akt signaling pathway
|
|
Antigen processing and presentation
|
|
NOD-like receptor signaling pathway
|
|
Progesterone-mediated oocyte maturation
|
|
Estrogen signaling pathway
|
|
Pathways in cancer
|
|
Prostate cancer
|
|
NetPath Pathway
|
IL2 Signaling Pathway
|
|
TCR Signaling Pathway
|
|
Pathway Interaction Database
|
Signaling events mediated by HDAC Class II
|
|
Validated targets of C-MYC transcriptional activation
|
|
Integrin-linked kinase signaling
|
|
LKB1 signaling events
|
|
Regulation of Telomerase
|
|
Glucocorticoid receptor regulatory network
|
|
Class I PI3K signaling events
|
|
IL2 signaling events mediated by PI3K
|
|
Regulation of Androgen receptor activity
|
|
Integrins in angiogenesis
|
|
Hypoxic and oxygen homeostasis regulation of HIF-1-alpha
|
|
ErbB receptor signaling network
|
|
VEGFR1 specific signals
|
|
Signaling events mediated by VEGFR1 and VEGFR2
|
|
Class I PI3K signaling events mediated by Akt
|
|
Reactome
|
Constitutive Signaling by Ligand-Responsive EGFR Cancer Variants
|
|
Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation
|
|
Regulation of actin dynamics for phagocytic cup formation
|
|
eNOS activation
|
|
Regulation of PLK1 Activity at G2/M Transition
|
|
Attenuation phase
|
|
HSF1-dependent transactivation
|
|
Loss of Nlp from mitotic centrosomes
|
|
Recruitment of mitotic centrosome proteins and complexes
|
|
Loss of proteins required for interphase microtubule organization?from the centrosome
|
|
EPHA-mediated growth cone collapse
|
|
VEGFA-VEGFR2 Pathway
|
|
VEGFR2 mediated vascular permeability
|
|
Anchoring of the basal body to the plasma membrane
|
|
Constitutive Signaling by EGFRvIII
|
|
WikiPathways
|
NRF2 pathway
|
|
Nuclear Receptors Meta-Pathway
|
|
Aryl Hydrocarbon Receptor Pathway
|
|
Binding and Uptake of Ligands by Scavenger Receptors
|
|
Signaling by ERBB2
|
|
Fcgamma receptor (FCGR) dependent phagocytosis
|
|
Influenza Life Cycle
|
|
EBV LMP1 signaling
|
|
Aryl Hydrocarbon Receptor
|
|
Corticotropin-releasing hormone
|
|
TNF alpha Signaling Pathway
|
|
Arylhydrocarbon receptor (AhR) signaling pathway
|
|
Signaling by EGFR
|
|
Semaphorin interactions
|
|
Mitotic G2-G2/M phases
|
|
Metabolism of nitric oxide
|
|
NOD pathway
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2010 Dec 15;20(24):7331-6. Epub 2010 Oct 21.In silico identification and biochemical evaluation of novel inhibitors of NRH:quinone oxidoreductase 2 (NQO2). |
|---|
