| Drug General Information |
| Drug ID |
D08DBE
|
| Former ID |
DIB007896
|
| Drug Name |
R-343
|
| Synonyms |
R-921303; Syk tyrosine kinase inhibitor (allergic asthma), Rigel/Pfizer
|
| Indication |
Asthma [ICD10:J45]
|
Discontinued in Phase 2 |
[1]
|
|---|
| Company |
Rigel Pharmaceuticals Inc
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Canonical SMILES |
c1(nc(c(cn1)F)Nc1cc2c(cc1)OC(C(=O)N2)(F)F)Nc1cc(ccc1)OC<br />C(=O)NC
|
| Target and Pathway |
| Target(s) |
Tyrosine-protein kinase SYK |
Target Info |
Inhibitor |
[2]
|
|---|
|
KEGG Pathway
|
NF-kappa B signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Osteoclast differentiation
|
|
Platelet activation
|
|
Natural killer cell mediated cytotoxicity
|
|
B cell receptor signaling pathway
|
|
Fc epsilon RI signaling pathway
|
|
Fc gamma R-mediated phagocytosis
|
|
Tuberculosis
|
|
Epstein-Barr virus infection
|
|
Viral carcinogenesis
|
|
PANTHER Pathway
|
B cell activation
|
|
Pathway Interaction Database
|
Fc-epsilon receptor I signaling in mast cells
|
|
BCR signaling pathway
|
|
GMCSF-mediated signaling events
|
|
Atypical NF-kappaB pathway
|
|
Osteopontin-mediated events
|
|
FAS (CD95) signaling pathway
|
|
Thromboxane A2 receptor signaling
|
|
IL2-mediated signaling events
|
|
Class I PI3K signaling events
|
|
Alpha-synuclein signaling
|
|
PathWhiz Pathway
|
Fc Epsilon Receptor I Signaling in Mast Cells
|
|
Reactome
|
GPVI-mediated activation cascade
|
|
FCGR activation
|
|
Regulation of actin dynamics for phagocytic cup formation
|
|
Role of phospholipids in phagocytosis
|
|
DAP12 signaling
|
|
Fc epsilon receptor (FCERI) signaling
|
|
Role of LAT2/NTAL/LAB on calcium mobilization
|
|
FCERI mediated MAPK activation
|
|
FCERI mediated Ca+2 mobilization
|
|
Integrin alphaIIb beta3 signaling
|
|
Interleukin-2 signaling
|
|
CLEC7A (Dectin-1) signaling
|
|
Dectin-2 family
|
|
Regulation of signaling by CBL
|
|
Antigen activates B Cell Receptor (BCR) leading to generation of second messengers
|
|
WikiPathways
|
IL-2 Signaling Pathway
|
|
IL-3 Signaling Pathway
|
|
Fc epsilon receptor (FCERI) signaling
|
|
Signaling by the B Cell Receptor (BCR)
|
|
Interleukin-2 signaling
|
|
Fcgamma receptor (FCGR) dependent phagocytosis
|
|
DAP12 interactions
|
|
B Cell Receptor Signaling Pathway
|
|
RANKL/RANK Signaling Pathway
|
|
Integrin alphaIIb beta3 signaling
|
|
GPVI-mediated activation cascade
|
|
Regulation of toll-like receptor signaling pathway
|
|
IL-5 Signaling Pathway
|
| References |
| REF 1 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800027577) |
|---|
| REF 2 | A novel Syk kinase inhibitor suitable for inhalation: R-343(. Expert Opin Ther Pat. 2009 Oct;19(10):1469-72. |
|---|
