| Drug General Information |
| Drug ID |
D0C3UC
|
| Former ID |
DIB007180
|
| Drug Name |
Ladostigil
|
| Synonyms |
Ladostigil tartrate; Alzheimer disease therapeutics, Teva; TV-3219; TV-3279; TV-3326
|
| Drug Type |
Small molecular drug
|
| Indication |
Alzheimer disease [ICD9: 331; ICD10:G30]
|
Phase 2 |
[1]
|
|---|
| Company |
Hebrew University of Jerusalem
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C16H20N2O2
|
| Canonical SMILES |
C(=O)(Oc1cc2c(CC[C@H]2NCC#C)cc1)N(CC)C
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Amine oxidase [flavin-containing] B |
Target Info |
Inhibitor |
[1]
|
|---|
| Amine oxidase [flavin-containing] A |
Target Info |
Inhibitor |
[1]
|
| Acetylcholinesterase |
Target Info |
Inhibitor |
[1]
|
|
BioCyc Pathway
|
Superpathway of tryptophan utilization
|
|
Tryptophan degradation via tryptamine
|
|
Dopamine degradation
|
|
Putrescine degradation III
|
|
Noradrenaline and adrenaline degradationPWY66-401:Superpathway of tryptophan utilization
|
|
Noradrenaline and adrenaline degradation
|
|
Serotonin degradation
|
|
Superpathway of melatonin degradation
|
|
Melatonin degradation II
|
|
KEGG Pathway
|
Glycine, serine and threonine metabolism
|
|
Arginine and proline metabolism
|
|
Histidine metabolism
|
|
Tyrosine metabolism
|
|
Phenylalanine metabolism
|
|
Tryptophan metabolism
|
|
Drug metabolism - cytochrome P450
|
|
Metabolic pathways
|
|
Serotonergic synapse
|
|
Dopaminergic synapse
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Alcoholismhsa00260:Glycine, serine and threonine metabolism
|
|
Alcoholismhsa00564:Glycerophospholipid metabolism
|
|
Cholinergic synapse
|
|
NetPath Pathway
|
IL4 Signaling Pathway
|
|
PANTHER Pathway
|
Adrenaline and noradrenaline biosynthesis
|
|
5-Hydroxytryptamine degredation
|
|
Dopamine receptor mediated signaling pathwayP00001:Adrenaline and noradrenaline biosynthesis
|
|
Dopamine receptor mediated signaling pathwayP00042:Muscarinic acetylcholine receptor 1 and 3 signaling pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathway
|
|
Nicotinic acetylcholine receptor signaling pathway
|
|
Pathway Interaction Database
|
Alpha-synuclein signalingatf2_pathway:ATF-2 transcription factor network
|
|
PathWhiz Pathway
|
Histidine Metabolism
|
|
Tyrosine Metabolism
|
|
Glycine and Serine MetabolismPW000048:Phospholipid Biosynthesis
|
|
Reactome
|
Norepinephrine Neurotransmitter Release Cycle
|
|
WikiPathways
|
Tryptophan metabolism
|
|
Dopamine metabolism
|
|
Phase 1 - Functionalization of compoundsWP706:SIDS Susceptibility Pathways
|
|
Biogenic Amine Synthesis
|
|
Oxidative Stress
|
|
Phase 1 - Functionalization of compounds
|
|
Neurotransmitter Release Cycle
|
|
Neurotransmitter Clearance In The Synaptic Cleft
|
|
Serotonin Transporter ActivityWP727:Monoamine Transport
|
|
Acetylcholine Synthesis
|
|
Integrated Pancreatic Cancer Pathway
|
| References |
| REF 1 | Ladostigil: a novel multimodal neuroprotective drug with cholinesterase and brain-selective monoamine oxidase inhibitory activities for Alzheimer's disease treatment. Curr Drug Targets. 2012 Apr;13(4):483-94. |
|---|
