| Drug General Information |
| Drug ID |
D0H7PW
|
| Former ID |
DNC014176
|
| Drug Name |
PIPERINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Vitiligo [ICD9: 709.01; ICD10:L80]
|
Phase 1/2 |
[1],
[2]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C17H19NO3
|
| InChI |
InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+
|
| InChIKey |
MXXWOMGUGJBKIW-YPCIICBESA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
6615, 84021, 589162, 1916561, 3134289, 8138057, 8144276, 8149678, 8704601, 10321424, 10538527, 10584664, 11537714, 14775491, 24898568, 24901388, 26531569, 26612115, 26680012, 26748436, 26748437, 26753730, 29204493, 43760287, 47365277, 47440351, 47662373, 47885490, 47959849, 48110525, 48259326, 48414997, 48423957, 49698510, 49748464, 49856282, 50107401, 50107402, 53789346, 53801087, 56463241, 57394548, 57407729, 78531100, 81065204, 81092942, 85272433, 87574654, 88802195, 92124496
|
| Target and Pathway |
| Target(s) |
Amine oxidase [flavin-containing] A |
Target Info |
Inhibitor |
[3]
|
|---|
| Amine oxidase [flavin-containing] B |
Target Info |
Inhibitor |
[3]
|
|
BioCyc Pathway
|
Superpathway of tryptophan utilization
|
|
Dopamine degradation
|
|
Putrescine degradation III
|
|
Noradrenaline and adrenaline degradation
|
|
Serotonin degradation
|
|
Superpathway of melatonin degradation
|
|
Melatonin degradation IIPWY66-401:Superpathway of tryptophan utilization
|
|
Tryptophan degradation via tryptamine
|
|
KEGG Pathway
|
Glycine, serine and threonine metabolism
|
|
Arginine and proline metabolism
|
|
Histidine metabolism
|
|
Tyrosine metabolism
|
|
Phenylalanine metabolism
|
|
Tryptophan metabolism
|
|
Drug metabolism - cytochrome P450
|
|
Metabolic pathways
|
|
Serotonergic synapse
|
|
Dopaminergic synapse
|
|
Cocaine addiction
|
|
Amphetamine addiction
|
|
Alcoholismhsa00260:Glycine, serine and threonine metabolism
|
|
Alcoholism
|
|
NetPath Pathway
|
IL4 Signaling Pathway
|
|
PANTHER Pathway
|
Adrenaline and noradrenaline biosynthesis
|
|
5-Hydroxytryptamine degredation
|
|
Dopamine receptor mediated signaling pathwayP00001:Adrenaline and noradrenaline biosynthesis
|
|
Dopamine receptor mediated signaling pathway
|
|
Pathway Interaction Database
|
Alpha-synuclein signaling
|
|
PathWhiz Pathway
|
Histidine Metabolism
|
|
Tyrosine Metabolism
|
|
Glycine and Serine Metabolism
|
|
Reactome
|
Norepinephrine Neurotransmitter Release Cycle
|
|
WikiPathways
|
SIDS Susceptibility Pathways
|
|
Biogenic Amine Synthesis
|
|
Oxidative Stress
|
|
Dopamine metabolism
|
|
Phase 1 - Functionalization of compounds
|
|
Neurotransmitter Release Cycle
|
|
Neurotransmitter Clearance In The Synaptic Cleft
|
|
Serotonin Transporter ActivityWP465:Tryptophan metabolism
|
| References |
| REF 1 | ClinicalTrials.gov (NCT01383694) Effect Of Piperine In Patients With Oropharyngeal Dysphagia. U.S. National Institutes of Health. |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 2489). |
|---|
| REF 3 | Bioorg Med Chem Lett. 2010 Jan 15;20(2):537-40. Epub 2009 Nov 26.Proposed structural basis of interaction of piperine and related compounds with monoamine oxidases. |
|---|
