| Drug General Information |
| Drug ID |
D01EUD
|
| Former ID |
DIB010181
|
| Drug Name |
SB-2343
|
| Synonyms |
SB-2312; MTOR/PI3K alpha dual inhibitors (cancer), S*BIO; Mammalian target of rapamycin/phosphoinositide 3 kinase alpha dual inhibitors (cancer), S*Bio
|
| Drug Type |
Small molecular drug
|
| Indication |
Cancer [ICD9: 140-229; ICD10:C00-C96]
|
Investigative |
[1]
|
|---|
| Company |
S*BIO Pte Ltd
|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C17H22N8O
|
| Canonical SMILES |
CC1=NC2=C(N=C(N=C2N1C(C)C)N3CCOCC3)C4=CN=C(N=C4)N
|
| InChI |
1S/C17H22N8O/c1-10(2)25-11(3)21-14-13(12-8-19-16(18)20-9-12)22-17(23-15(14)25)24-4-6-26-7-5-24/h8-10H,4-7H2,1-3H3,(H2,18,19,20)
|
| InChIKey |
QYBGBLQCOOISAR-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
99376660, 120919500, 163621035, 163686364, 169548936, 184824937, 208265527, 223382832, 223702838, 224593968, 226848955, 241383889, 245285867, 249683938, 250225766, 252074133, 252166594, 252216594, 252444830, 252473852
|
| Target and Pathway |
| Target(s) |
Serine/threonine-protein kinase mTOR |
Target Info |
Inhibitor |
[1]
|
|---|
|
KEGG Pathway
|
ErbB signaling pathway
|
|
HIF-1 signaling pathway
|
|
mTOR signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
AMPK signaling pathway
|
|
Insulin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Adipocytokine signaling pathway
|
|
Type II diabetes mellitus
|
|
Pathways in cancer
|
|
Proteoglycans in cancer
|
|
MicroRNAs in cancer
|
|
Glioma
|
|
Prostate cancer
|
|
Acute myeloid leukemia
|
|
Central carbon metabolism in cancer
|
|
Choline metabolism in cancer
|
|
PANTHER Pathway
|
Hypoxia response via HIF activation
|
|
Interleukin signaling pathway
|
|
Pathway Interaction Database
|
IL4-mediated signaling events
|
|
Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met)
|
|
IL12-mediated signaling events
|
|
CDC42 signaling events
|
|
LKB1 signaling events
|
|
Regulation of Telomerase
|
|
mTOR signaling pathway
|
|
CXCR4-mediated signaling events
|
|
EGFR-dependent Endothelin signaling events
|
|
IL2 signaling events mediated by PI3K
|
|
IFN-gamma pathway
|
|
ErbB1 downstream signaling
|
|
ErbB2/ErbB3 signaling events
|
|
CXCR3-mediated signaling events
|
|
Class I PI3K signaling events mediated by Akt
|
|
PathWhiz Pathway
|
Leucine Stimulation on Insulin Signaling
|
|
Reactome
|
PIP3 activates AKT signaling
|
|
Macroautophagy
|
|
mTORC1-mediated signalling
|
|
HSF1-dependent transactivation
|
|
CD28 dependent PI3K/Akt signaling
|
|
VEGFR2 mediated vascular permeability
|
|
TP53 Regulates Metabolic Genes
|
|
Constitutive Signaling by AKT1 E17K in Cancer
|
|
WikiPathways
|
ErbB Signaling Pathway
|
|
Senescence and Autophagy in Cancer
|
|
Interferon type I signaling pathways
|
|
Insulin Signaling
|
|
EGF/EGFR Signaling Pathway
|
|
Wnt Signaling Pathway Netpath
|
|
Extracellular vesicle-mediated signaling in recipient cells
|
|
Cardiac Hypertrophic Response
|
|
Signaling by Type 1 Insulin-like Growth Factor 1 Receptor (IGF1R)
|
|
PIP3 activates AKT signaling
|
|
Polycystic Kidney Disease Pathway
|
|
Alpha 6 Beta 4 signaling pathway
|
|
BDNF signaling pathway
|
|
Oncostatin M Signaling Pathway
|
|
Prostate Cancer
|
|
TSLP Signaling Pathway
|
|
FSH signaling pathway
|
|
Leptin signaling pathway
|
|
TSH signaling pathway
|
|
RANKL/RANK Signaling Pathway
|
|
SREBF and miR33 in cholesterol and lipid homeostasis
|
|
Integrated Breast Cancer Pathway
|
|
SREBP signalling
|
|
Signaling by Insulin receptor
|
|
Costimulation by the CD28 family
|
|
Type II diabetes mellitus
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
TOR Signaling
|
|
AMPK Signaling
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Target id: 2109). |
|---|
