| Drug General Information |
| Drug ID |
D04UNQ
|
| Former ID |
DNC006932
|
| Drug Name |
4-(phenyldiazenyl)-1H-pyrazole-3,5-diamine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C9H10N6
|
| Canonical SMILES |
C1=CC=C(C=C1)NN=C2C(=NN=C2N)N
|
| InChI |
1S/C9H10N6/c10-8-7(9(11)15-14-8)13-12-6-4-2-1-3-5-6/h1-5,12H,(H4,10,11,13,14,15)
|
| InChIKey |
OKZNBFAXFGTZRH-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
Cyclin-A2 |
Target Info |
Inhibitor |
[1]
|
|---|
| Cell division protein kinase 9 |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
DNA replication
|
|
Base excision repair
|
|
Nucleotide excision repair
|
|
Mismatch repair
|
|
Cell cycle
|
|
Hepatitis B
|
|
HTLV-I infectionhsa05202:Transcriptional misregulation in cancer
|
|
NetPath Pathway
|
EGFR1 Signaling Pathway
|
|
PathWhiz Pathway
|
Nucleotide Excision Repair
|
|
Reactome
|
E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Cdc20:Phospho-APC/C mediated degradation of Cyclin A
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
SCF(Skp2)-mediated degradation of p27/p21
|
|
Senescence-Associated Secretory Phenotype (SASP)
|
|
Mismatch repair (MMR) directed by MSH2:MSH6 (MutSalpha)
|
|
Mismatch repair (MMR) directed by MSH2:MSH3 (MutSbeta)
|
|
HDR through Homologous Recombination (HRR)
|
|
Processing of DNA double-strand break ends
|
|
Dual Incision in GG-NER
|
|
Dual incision in TC-NER
|
|
Gap-filling DNA repair synthesis and ligation in TC-NER
|
|
G2 Phase
|
|
Orc1 removal from chromatin
|
|
G1/S-Specific Transcription
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
Cyclin A:Cdk2-associated events at S phase entryR-HSA-2173796:SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription
|
|
WikiPathways
|
Senescence and Autophagy in Cancer
|
|
Mismatch repair
|
|
DNA Replication
|
|
G1 to S cell cycle control
|
|
EGF/EGFR Signaling Pathway
|
|
S Phase
|
|
Nifedipine Activity
|
|
Primary Focal Segmental Glomerulosclerosis FSGS
|
|
Retinoblastoma (RB) in Cancer
|
|
Integrated Pancreatic Cancer Pathway
|
|
Nucleotide Excision Repair
|
|
Telomere Maintenance
|
|
Synthesis of DNA
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
Base Excision RepairWP2795:Cardiac Hypertrophic Response
|
|
Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer
|
|
Host Interactions of HIV factors
|
|
HIV Life Cycle
|
|
IL-9 Signaling Pathway
|
|
RNA Polymerase II Transcription
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
| References |
| REF 1 | J Med Chem. 2006 Nov 2;49(22):6500-9.4-arylazo-3,5-diamino-1H-pyrazole CDK inhibitors: SAR study, crystal structure in complex with CDK2, selectivity, and cellular effects. |
|---|
