| Drug General Information |
| Drug ID |
D06GBK
|
| Former ID |
DNC006594
|
| Drug Name |
AG1295
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Terminated |
[1],
[2]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C16H14N2
|
| InChI |
InChI=1S/C16H14N2/c1-11-8-14-15(9-12(11)2)18-16(10-17-14)13-6-4-3-5-7-13/h3-10H,1-2H3
|
| InChIKey |
FQNCLVJEQCJWSU-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
470303, 1000330, 3417230, 5600220, 8151400, 11217406, 11359042, 14798231, 26756730, 26759700, 26980594, 29221230, 47810555, 48110257, 48259029, 48334276, 49671139, 53800472, 57321115, 75642572, 85267026, 85774668, 85787242, 85789449, 87660072, 92236280, 99297304, 99302809, 103147273, 103165289, 103855934, 104051603, 104299454, 105873553, 117399478, 117417078, 117521044, 124613740, 125174854, 127885135, 130184172, 131387858, 134343799, 135727804, 137025800, 144025103, 162225363, 162655815, 163687162, 164928447
|
| Target and Pathway |
| Target(s) |
FL cytokine receptor |
Target Info |
Inhibitor |
[3]
|
|---|
| Beta platelet-derived growth factor receptor |
Target Info |
Inhibitor |
[3]
|
| Vascular endothelial growth factor receptor 2 |
Target Info |
Inhibitor |
[4]
|
| Alpha platelet-derived growth factor receptor |
Target Info |
Inhibitor |
[5]
|
|
KEGG Pathway
|
Cytokine-cytokine receptor interaction
|
|
Hematopoietic cell lineage
|
|
Pathways in cancer
|
|
Transcriptional misregulation in cancer
|
|
Acute myeloid leukemia
|
|
Central carbon metabolism in cancerhsa04010:MAPK signaling pathway
|
|
Ras signaling pathway
|
|
Rap1 signaling pathway
|
|
Calcium signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Focal adhesion
|
|
Gap junction
|
|
Regulation of actin cytoskeleton
|
|
HTLV-I infection
|
|
MicroRNAs in cancer
|
|
Glioma
|
|
Prostate cancer
|
|
Melanoma
|
|
Central carbon metabolism in cancer
|
|
Choline metabolism in cancerhsa04014:Ras signaling pathway
|
|
Endocytosis
|
|
VEGF signaling pathway
|
|
Proteoglycans in cancerhsa04010:MAPK signaling pathway
|
|
Choline metabolism in cancer
|
|
NetPath Pathway
|
IL2 Signaling PathwayNetPath_7:TGF_beta_Receptor Signaling Pathway
|
|
PANTHER Pathway
|
Angiogenesis
|
|
PDGF signaling pathwayP00005:Angiogenesis
|
|
VEGF signaling pathwayP00005:Angiogenesis
|
|
PDGF signaling pathway
|
|
Pathway Interaction Database
|
Signaling events mediated by PTP1B
|
|
Beta3 integrin cell surface interactions
|
|
S1P3 pathway
|
|
Nectin adhesion pathway
|
|
Signaling events mediated by TCPTP
|
|
SHP2 signaling
|
|
S1P1 pathway
|
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling
|
|
PDGFR-beta signaling pathway
|
|
Validated targets of C-MYC transcriptional repression
|
|
PDGF receptor signaling networkhif2pathway:HIF-2-alpha transcription factor network
|
|
VEGF and VEGFR signaling network
|
|
Integrins in angiogenesis
|
|
Signaling events mediated by VEGFR1 and VEGFR2
|
|
Notch-mediated HES/HEY networkatf2_pathway:ATF-2 transcription factor network
|
|
PDGFR-alpha signaling pathway
|
|
PDGF receptor signaling network
|
|
Reactome
|
PIP3 activates AKT signaling
|
|
Constitutive Signaling by Aberrant PI3K in Cancer
|
|
RAF/MAP kinase cascadeR-HSA-194306:Neurophilin interactions with VEGF and VEGFR
|
|
VEGF binds to VEGFR leading to receptor dimerization
|
|
Integrin cell surface interactions
|
|
EPHA-mediated growth cone collapse
|
|
VEGFA-VEGFR2 Pathway
|
|
VEGFR2 mediated cell proliferationR-HSA-1257604:PIP3 activates AKT signaling
|
|
RAF/MAP kinase cascade
|
|
WikiPathways
|
Regulation of Actin Cytoskeleton
|
|
MAPK Signaling Pathway
|
|
Osteoblast Signaling
|
|
Focal Adhesion
|
|
PIP3 activates AKT signaling
|
|
PDGF Pathway
|
|
Signaling Pathways in Glioblastoma
|
|
Signaling by PDGFWP306:Focal Adhesion
|
|
Nifedipine Activity
|
|
Cardiac Progenitor Differentiation
|
|
Signaling by VEGF
|
|
AngiogenesisWP51:Regulation of Actin Cytoskeleton
|
|
Hair Follicle Development: Organogenesis (Part 2 of 3)
|
|
Integrated Pancreatic Cancer Pathway
|
|
Allograft Rejection
|
|
Signaling by PDGF
|
|
Angiogenesis
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 5914). |
|---|
| REF 2 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800007894) |
|---|
| REF 3 | Bioorg Med Chem. 2007 Mar 1;15(5):2187-97. Epub 2006 Dec 12.Inhibition of FLT3 and PDGFR tyrosine kinase activity by bis(benzo[b]furan-2-yl)methanones. |
|---|
| REF 4 | Bioorg Med Chem. 2009 Oct 15;17(20):7324-36. Epub 2009 Aug 22.Design, synthesis, and X-ray crystal structures of 2,4-diaminofuro[2,3-d]pyrimidines as multireceptor tyrosine kinase and dihydrofolate reductase inhibitors. |
|---|
| REF 5 | J Med Chem. 2006 Jun 1;49(11):3101-15.Novel bis(1H-indol-2-yl)methanones as potent inhibitors of FLT3 and platelet-derived growth factor receptor tyrosine kinase. |
|---|
