| Drug General Information |
| Drug ID |
D0C5GF
|
| Former ID |
DIB020393
|
| Drug Name |
MPDT
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C19H22N2O
|
| InChI |
InChI=1S/C19H22N2O/c1-21(2)12-11-16-17-13-15(22-3)9-10-18(17)20-19(16)14-7-5-4-6-8-14/h4-10,13,20H,11-12H2,1-3H3
|
| InChIKey |
VSGPGYWZVPDDSK-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
14849307, 23950833, 43529885, 47359943, 48254012, 79387134, 103165505, 103985380, 114788095, 126522461, 129519717, 135650627, 141679217, 198970627, 231555087, 241376388, 249617832, 252157197
|
| Target and Pathway |
| Target(s) |
5-hydroxytryptamine 2A receptor |
Target Info |
Antagonist |
[2]
|
|---|
| 5-hydroxytryptamine 1A receptor |
Target Info |
Antagonist |
[2]
|
| 5-hydroxytryptamine 1D receptor |
Target Info |
Antagonist |
[2]
|
| 5-hydroxytryptamine 5A receptor |
Target Info |
Antagonist |
[2]
|
| 5-hydroxytryptamine 2C receptor |
Target Info |
Antagonist |
[2]
|
| 5-hydroxytryptamine 7 receptor |
Target Info |
Antagonist |
[2]
|
| 5-hydroxytryptamine 6 receptor |
Target Info |
Antagonist |
[2]
|
|
KEGG Pathway
|
Calcium signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Gap junction
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04024:cAMP signaling pathway
|
|
Serotonergic synapsehsa04024:cAMP signaling pathway
|
|
Serotonergic synapsehsa04020:Calcium signaling pathway
|
|
Inflammatory mediator regulation of TRP channelshsa04014:Ras signaling pathway
|
|
cAMP signaling pathway
|
|
PANTHER Pathway
|
5HT2 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
5HT1 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP04374:5HT2 type receptor mediated signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
PathWhiz Pathway
|
Excitatory Neural Signalling Through 5-HTR 7 and SerotoninPW000444:Excitatory Neural Signalling Through 5-HTR 6 and Serotonin
|
|
Reactome
|
Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (s) signalling events
|
|
WikiPathways
|
Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
SIDS Susceptibility Pathways
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
GPCRs, OtherWP722:Serotonin HTR1 Group and FOS Pathway
|
|
GPCR downstream signalingWP722:Serotonin HTR1 Group and FOS Pathway
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
GPCR downstream signalingWP732:Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
GPCR downstream signalingWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
|
GPCRs, OtherWP734:Serotonin Receptor 4/6/7 and NR3C Signaling
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 71). |
|---|
| REF 2 | 2-Substituted tryptamines: agents with selectivity for 5-HT(6) serotonin receptors. J Med Chem. 2000 Mar 9;43(5):1011-8. |
|---|
