| Drug General Information |
| Drug ID |
D0GQ9Q
|
| Former ID |
DNCL003700
|
| Drug Name |
CHU
|
| Synonyms |
Tofogliflozin
|
| Drug Type |
Small molecular drug
|
| Indication |
Enthesopathy; Type 2 diabetes [ICD9: 726, 250; ICD10:M76-M77.9, E11]
|
Registered |
[1]
|
|---|
| Company |
Chugai; Roche
|
| Formula |
C22H28O7
|
| Canonical SMILES |
CCC1=CC=C(C=C1)CC2=CC3=C(COC34C(C(C(C(O4)CO)O)O)O)C=C2.<br />O
|
| InChI |
1S/C22H26O6.H2O/c1-2-13-3-5-14(6-4-13)9-15-7-8-16-12-27-22(17(16)10-15)21(26)20(25)19(24)18(11-23)28-22;/h3-8,10,18-21,23-26H,2,9,11-12H2,1H3;1H2/t18-,19-,20+,21-,22+;/m1./s1
|
| InChIKey |
ZXOCGDDVNPDRIW-NHFZGCSJSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
|
| Target and Pathway |
| Target(s) |
Phosphoinositide 3 kinase |
Target Info |
Inhibitor |
[2]
|
|---|
| Interleukin-6 receptor |
Target Info |
Modulator |
[3]
|
|
KEGG Pathway
|
Inositol phosphate metabolism
|
|
ErbB signaling pathway
|
|
Ras signaling pathway
|
|
Rap1 signaling pathway
|
|
cGMP-PKG signaling pathway
|
|
cAMP signaling pathway
|
|
Chemokine signaling pathway
|
|
HIF-1 signaling pathway
|
|
FoxO signaling pathway
|
|
Phosphatidylinositol signaling system
|
|
Sphingolipid signaling pathway
|
|
mTOR signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
AMPK signaling pathway
|
|
Apoptosis
|
|
Adrenergic signaling in cardiomyocytes
|
|
VEGF signaling pathway
|
|
Osteoclast differentiation
|
|
Focal adhesion
|
|
Signaling pathways regulating pluripotency of stem cells
|
|
Platelet activation
|
|
Toll-like receptor signaling pathway
|
|
Jak-STAT signaling pathway
|
|
Natural killer cell mediated cytotoxicity
|
|
T cell receptor signaling pathway
|
|
B cell receptor signaling pathway
|
|
Fc epsilon RI signaling pathway
|
|
Fc gamma R-mediated phagocytosis
|
|
TNF signaling pathway
|
|
Leukocyte transendothelial migration
|
|
Neurotrophin signaling pathway
|
|
Cholinergic synapse
|
|
Inflammatory mediator regulation of TRP channels
|
|
Regulation of actin cytoskeleton
|
|
Insulin signaling pathway
|
|
Progesterone-mediated oocyte maturation
|
|
Estrogen signaling pathway
|
|
Prolactin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Oxytocin signaling pathway
|
|
Regulation of lipolysis in adipocytes
|
|
Type II diabetes mellitus
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Aldosterone-regulated sodium reabsorption
|
|
Carbohydrate digestion and absorption
|
|
Bacterial invasion of epithelial cells
|
|
Chagas disease (American trypanosomiasis)
|
|
Toxoplasmosis
|
|
Amoebiasis
|
|
Hepatitis C
|
|
Hepatitis B
|
|
Measles
|
|
Influenza A
|
|
HTLV-I infection
|
|
Epstein-Barr virus infection
|
|
Pathways in cancer
|
|
Viral carcinogenesis
|
|
Proteoglycans in cancer
|
|
MicroRNAs in cancer
|
|
Colorectal cancer
|
|
Renal cell carcinoma
|
|
Pancreatic cancer
|
|
Endometrial cancer
|
|
Glioma
|
|
Prostate cancer
|
|
Melanoma
|
|
Chronic myeloid leukemia
|
|
Acute myeloid leukemia
|
|
Small cell lung cancer
|
|
Non-small cell lung cancer
|
|
Central carbon metabolism in cancer
|
|
Choline metabolism in cancerhsa04060:Cytokine-cytokine receptor interaction
|
|
Hematopoietic cell lineage
|
|
PathWhiz Pathway
|
Inositol Metabolism
|
|
Phosphatidylinositol Phosphate Metabolism
|
|
Intracellular Signalling Through Adenosine Receptor A2a and Adenosine
|
|
Intracellular Signalling Through Adenosine Receptor A2b and Adenosine
|
|
Fc Epsilon Receptor I Signaling in Mast Cells
|
|
Reactome
|
PI3K Cascade
|
|
GPVI-mediated activation cascade
|
|
Constitutive Signaling by Ligand-Responsive EGFR Cancer Variants
|
|
PI3K events in ERBB4 signaling
|
|
PIP3 activates AKT signaling
|
|
GAB1 signalosome
|
|
PI3K events in ERBB2 signaling
|
|
PI3K/AKT activation
|
|
Role of phospholipids in phagocytosis
|
|
Tie2 Signaling
|
|
Constitutive Signaling by Aberrant PI3K in Cancer
|
|
DAP12 signaling
|
|
Role of LAT2/NTAL/LAB on calcium mobilization
|
|
Nephrin interactions
|
|
Costimulation by the CD28 family
|
|
CD28 dependent PI3K/Akt signaling
|
|
G beta:gamma signalling through PI3Kgamma
|
|
G alpha (q) signalling events
|
|
G alpha (12/13) signalling events
|
|
VEGFA-VEGFR2 Pathway
|
|
Interleukin-3, 5 and GM-CSF signaling
|
|
Constitutive Signaling by EGFRvIII
|
|
PI-3K cascade:FGFR1
|
|
PI-3K cascade:FGFR2
|
|
PI-3K cascade:FGFR3
|
|
PI-3K cascade:FGFR4
|
|
Interleukin receptor SHC signaling
|
|
Regulation of signaling by CBLR-HSA-110056:MAPK3 (ERK1) activation
|
|
MAPK1 (ERK2) activation
|
|
WikiPathways
|
Toll-like receptor signaling pathway
|
|
Serotonin HTR1 Group and FOS Pathway
|
|
DNA Damage Response (only ATM dependent)
|
|
G13 Signaling Pathway
|
|
Regulation of Actin Cytoskeleton
|
|
Insulin Signaling
|
|
IL-4 Signaling Pathway
|
|
Copper homeostasis
|
|
Signaling of Hepatocyte Growth Factor Receptor
|
|
Transcriptional activation by NRF2
|
|
IL1 and megakaryotyces in obesity
|
|
Signaling by ERBB4
|
|
Signaling by ERBB2
|
|
Fc epsilon receptor (FCERI) signaling
|
|
PI Metabolism
|
|
Interleukin-2 signaling
|
|
Fcgamma receptor (FCGR) dependent phagocytosis
|
|
Signaling by SCF-KIT
|
|
DAP12 interactions
|
|
Signaling by Type 1 Insulin-like Growth Factor 1 Receptor (IGF1R)
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
PIP3 activates AKT signaling
|
|
Integrated Pancreatic Cancer Pathway
|
|
Prostate Cancer
|
|
Signaling Pathways in Glioblastoma
|
|
TSLP Signaling Pathway
|
|
Regulation of Microtubule Cytoskeleton
|
|
TSH signaling pathway
|
|
SREBP signalling
|
|
TCR signaling
|
|
Signaling by PDGF
|
|
Signaling by Insulin receptor
|
|
Signaling by FGFR
|
|
Signaling by EGFR
|
|
NGF signalling via TRKA from the plasma membrane
|
|
Nephrin interactions
|
|
Interleukin-3, 5 and GM-CSF signaling
|
|
GPVI-mediated activation cascade
|
|
GPCR downstream signaling
|
|
Costimulation by the CD28 family
|
|
Cell surface interactions at the vascular wall
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Angiogenesis
|
|
Regulation of toll-like receptor signaling pathway
|
|
AMPK SignalingWP706:SIDS Susceptibility Pathways
|
|
Senescence and Autophagy in Cancer
|
|
IL-6 signaling pathway
|
|
Differentiation Pathway
|
|
Interleukin-6 signaling
|
| References |
| REF 1 | Trusted, scientifically sound profiles of drug programs, clinical trials, safety reports, and company deals, written by scientists. Springer. 2015. Adis Insight (drug id 800027532) |
|---|
| REF 2 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Target id: 2156). |
|---|
| REF 3 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Target id: 2310). |
|---|
