| Drug General Information |
| Drug ID |
D0P0IX
|
| Former ID |
DNC004166
|
| Drug Name |
ISOCLOZAPINE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C18H19ClN4
|
| Canonical SMILES |
CN1CCN(CC1)C2=NC3=CC=CC=C3NC4=C2C=C(C=C4)Cl
|
| InChI |
1S/C18H19ClN4/c1-22-8-10-23(11-9-22)18-14-12-13(19)6-7-15(14)20-16-4-2-3-5-17(16)21-18/h2-7,12,20H,8-11H2,1H3
|
| InChIKey |
APOMSSAGEAOUGO-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
D(2) dopamine receptor |
Target Info |
Inhibitor |
[1]
|
|---|
| Alpha-1A adrenergic receptor |
Target Info |
Inhibitor |
[1]
|
| D(4) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
| 5-hydroxytryptamine 2A receptor |
Target Info |
Inhibitor |
[1]
|
| Dopamine D1 receptor |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M4 |
Target Info |
Inhibitor |
[3]
|
| Alpha-1D adrenergic receptor |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M5 |
Target Info |
Inhibitor |
[3]
|
| D(1B) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
| D(3) dopamine receptor |
Target Info |
Inhibitor |
[2]
|
| Muscarinic acetylcholine receptor M3 |
Target Info |
Inhibitor |
[3]
|
| Alpha-1B adrenergic receptor |
Target Info |
Inhibitor |
[1]
|
| Muscarinic acetylcholine receptor M1 |
Target Info |
Inhibitor |
[3]
|
| Muscarinic acetylcholine receptor M2 |
Target Info |
Inhibitor |
[3]
|
|
KEGG Pathway
|
Rap1 signaling pathway
|
|
cAMP signaling pathway
|
|
Neuroactive ligand-receptor interaction
|
|
Gap junction
|
|
Dopaminergic synapse
|
|
Parkinson's disease
|
|
Cocaine addiction
|
|
Alcoholismhsa04020:Calcium signaling pathway
|
|
cGMP-PKG signaling pathway
|
|
AMPK signaling pathway
|
|
Adrenergic signaling in cardiomyocytes
|
|
Vascular smooth muscle contraction
|
|
Salivary secretionhsa04080:Neuroactive ligand-receptor interaction
|
|
Dopaminergic synapsehsa04020:Calcium signaling pathway
|
|
Serotonergic synapse
|
|
Inflammatory mediator regulation of TRP channelshsa04020:Calcium signaling pathway
|
|
Amphetamine addiction
|
|
Morphine addiction
|
|
Alcoholismhsa04080:Neuroactive ligand-receptor interaction
|
|
Cholinergic synapse
|
|
Regulation of actin cytoskeletonhsa04020:Calcium signaling pathway
|
|
Salivary secretionhsa04020:Calcium signaling pathway
|
|
Dopaminergic synapsehsa04080:Neuroactive ligand-receptor interaction
|
|
Regulation of actin cytoskeleton
|
|
Insulin secretion
|
|
Salivary secretion
|
|
Gastric acid secretion
|
|
Pancreatic secretionhsa04020:Calcium signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
NetPath Pathway
|
IL2 Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
PANTHER Pathway
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathway
|
|
Dopamine receptor mediated signaling pathway
|
|
Nicotine pharmacodynamics pathwayP00002:Alpha adrenergic receptor signaling pathwayP00026:Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Nicotine pharmacodynamics pathwayP04374:5HT2 type receptor mediated signaling pathwayP05912:Dopamine receptor mediated signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Heterotrimeric G-protein signaling pathway-Gq alpha and Go alpha mediated pathwayP05912:Dopamine receptor mediated signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00002:Alpha adrenergic receptor signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 1 and 3 signaling pathwayP00003:Alzheimer disease-amyloid secretase pathway
|
|
Muscarinic acetylcholine receptor 2 and 4 signaling pathway
|
|
Pathway Interaction Database
|
LPA receptor mediated events
|
|
PathWhiz Pathway
|
Dopamine Activation of Neurological Reward SystemPW000565:Gastric Acid ProductionPW000564:Muscle/Heart Contraction
|
|
Reactome
|
Dopamine receptors
|
|
G alpha (i) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (q) signalling events
|
|
G alpha (12/13) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (i) signalling eventsR-HSA-390666:Serotonin receptors
|
|
G alpha (q) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (s) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (12/13) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (s) signalling eventsR-HSA-390651:Dopamine receptors
|
|
G alpha (i) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
Acetylcholine regulates insulin secretion
|
|
G alpha (q) signalling eventsR-HSA-390696:Adrenoceptors
|
|
G alpha (q) signalling eventsR-HSA-390648:Muscarinic acetylcholine receptors
|
|
G alpha (i) signalling events
|
|
WikiPathways
|
Hypothetical Network for Drug Addiction
|
|
Monoamine GPCRs
|
|
GPCRs, Class A Rhodopsin-like
|
|
Genes and (Common) Pathways Underlying Drug Addiction
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Nicotine Activity on Dopaminergic NeuronsWP58:Monoamine GPCRs
|
|
Calcium Regulation in the Cardiac Cell
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Endothelin Pathways
|
|
AMPK SignalingWP666:Hypothetical Network for Drug Addiction
|
|
Nicotine Activity on Dopaminergic Neurons
|
|
GPCRs, OtherWP733:Serotonin Receptor 2 and STAT3 Signaling
|
|
Serotonin Receptor 2 and ELK-SRF/GATA4 signaling
|
|
SIDS Susceptibility Pathways
|
|
GPCRs, OtherWP666:Hypothetical Network for Drug Addiction
|
|
GPCR downstream signalingWP58:Monoamine GPCRs
|
|
Regulation of Actin Cytoskeleton
|
|
GPCRs, OtherWP58:Monoamine GPCRs
|
|
Integration of energy metabolism
|
|
Vitamin D Receptor Pathway
|
|
AMPK SignalingWP58:Monoamine GPCRs
|
|
Secretion of Hydrochloric Acid in Parietal Cells
|
|
GPCR downstream signalingWP706:SIDS Susceptibility Pathways
|
|
GPCRs, Other
|
| References |
| REF 1 | J Med Chem. 1997 Dec 5;40(25):4146-53.Synthesis and pharmacological evaluation of triflate-substituted analogues of clozapine: identification of a novel atypical neuroleptic. |
|---|
| REF 2 | J Med Chem. 1982 Jul;25(7):855-8.Affinity of 10-(4-methylpiperazino)dibenz[b,f]oxepins for clozapine and spiroperidol binding sites in rat brain. |
|---|
| REF 3 | J Med Chem. 1990 Feb;33(2):809-14.Chloro-substituted, sterically hindered 5,11-dicarbo analogues of clozapine as potential chiral antipsychotic agents. |
|---|
