| Drug General Information |
| Drug ID |
D0Q6MN
|
| Former ID |
DNC002457
|
| Drug Name |
4-Iodobenzo[B]Thiophene-2-Carboxamidine
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C9H7IN2S
|
| Canonical SMILES |
C1=CC2=C(C=C(S2)C(=N)N)C(=C1)I
|
| InChI |
1S/C9H7IN2S/c10-6-2-1-3-7-5(6)4-8(13-7)9(11)12/h1-4H,(H3,11,12)
|
| InChIKey |
YERQOXAYAFWFEJ-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
29220949, 46391621, 46391624, 46391627, 46392743, 54233493, 75700229, 103253617, 103854558, 103995228, 104298608, 129785137, 134340863, 140242022, 160966284, 162452052, 230254461
|
| Target and Pathway |
| Target(s) |
Coagulation factor IIa |
Target Info |
Inhibitor |
[1]
|
|---|
| Urokinase-type plasminogen activator |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
Neuroactive ligand-receptor interaction
|
|
Complement and coagulation cascades
|
|
Regulation of actin cytoskeletonhsa04064:NF-kappa B signaling pathway
|
|
Transcriptional misregulation in cancer
|
|
Proteoglycans in cancer
|
|
MicroRNAs in cancer
|
|
NetPath Pathway
|
TCR Signaling PathwayNetPath_14:IL2 Signaling Pathway
|
|
EGFR1 Signaling Pathway
|
|
PANTHER Pathway
|
Blood coagulationP00011:Blood coagulation
|
|
Plasminogen activating cascade
|
|
CCKR signaling map ST
|
|
Pathway Interaction Database
|
Thrombin/protease-activated receptor (PAR) pathway
|
|
Angiopoietin receptor Tie2-mediated signaling
|
|
FOXA2 and FOXA3 transcription factor networks
|
|
PAR4-mediated thrombin signaling events
|
|
Syndecan-4-mediated signaling events
|
|
PAR1-mediated thrombin signaling eventsintegrin1_pathway:Beta1 integrin cell surface interactions
|
|
E2F transcription factor network
|
|
Beta3 integrin cell surface interactions
|
|
Osteopontin-mediated events
|
|
Validated transcriptional targets of AP1 family members Fra1 and Fra2
|
|
amb2 Integrin signaling
|
|
ATF-2 transcription factor network
|
|
AP-1 transcription factor network
|
|
Beta2 integrin cell surface interactions
|
|
Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling
|
|
Beta5 beta6 beta7 and beta8 integrin cell surface interactions
|
|
FGF signaling pathway
|
|
PathWhiz Pathway
|
Vitamin K Metabolism
|
|
Coagulation
|
|
Reactome
|
Intrinsic Pathway of Fibrin Clot Formation
|
|
Common Pathway of Fibrin Clot Formation
|
|
Gamma-carboxylation of protein precursors
|
|
Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus
|
|
Removal of aminoterminal propeptides from gamma-carboxylated proteins
|
|
Cell surface interactions at the vascular wall
|
|
Peptide ligand-binding receptors
|
|
Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
G alpha (q) signalling events
|
|
Thrombin signalling through proteinase activated receptors (PARs)R-HSA-75205:Dissolution of Fibrin Clot
|
|
WikiPathways
|
Complement and Coagulation Cascades
|
|
Regulation of Actin Cytoskeleton
|
|
IL1 and megakaryotyces in obesity
|
|
Regulation of Insulin-like Growth Factor (IGF) Transport and Uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs)
|
|
PTM: gamma carboxylation, hypusine formation and arylsulfatase activation
|
|
Blood Clotting Cascade
|
|
Gastrin-CREB signalling pathway via PKC and MAPK
|
|
Thrombin signalling through proteinase activated receptors (PARs)
|
|
Platelet Aggregation (Plug Formation)
|
|
GPCR ligand binding
|
|
GPCR downstream signaling
|
|
Formation of Fibrin Clot (Clotting Cascade)
|
|
Cell surface interactions at the vascular wall
|
|
Folate Metabolism
|
|
Vitamin B12 Metabolism
|
|
Selenium Micronutrient NetworkWP710:DNA Damage Response (only ATM dependent)
|
|
Senescence and Autophagy in Cancer
|
|
Endochondral Ossification
|
|
Wnt Signaling Pathway
|
|
Wnt Signaling Pathway and Pluripotency
|
|
Dissolution of Fibrin Clot
|
|
Osteopontin Signaling
|
| References |
| REF 1 | The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
|---|
