| Drug General Information |
| Drug ID |
D08GWQ
|
| Former ID |
DNC006430
|
| Drug Name |
3-isopropyl-4-(phenylthio)naphthalene-1,2-dione
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C19H16O2S
|
| Canonical SMILES |
CC(C)C1=C(C2=CC=CC=C2C(=O)C1=O)SC3=CC=CC=C3
|
| InChI |
1S/C19H16O2S/c1-12(2)16-18(21)17(20)14-10-6-7-11-15(14)19(16)22-13-8-4-3-5-9-13/h3-12H,1-2H3
|
| InChIKey |
VHVWQYNOEGPBOE-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| Target and Pathway |
| Target(s) |
M-phase inducer phosphatase 2 |
Target Info |
Inhibitor |
[1]
|
|---|
| M-phase inducer phosphatase 1 |
Target Info |
Inhibitor |
[1]
|
| mRNA of Protein tyrosine phosphatase-1B |
Target Info |
Inhibitor |
[1]
|
|
KEGG Pathway
|
MAPK signaling pathway
|
|
Cell cycle
|
|
Progesterone-mediated oocyte maturation
|
|
MicroRNAs in cancerhsa04110:Cell cycle
|
|
MicroRNAs in cancerhsa04520:Adherens junction
|
|
Insulin signaling pathway
|
|
NetPath Pathway
|
IL2 Signaling Pathway
|
|
TGF_beta_Receptor Signaling Pathway
|
|
Wnt Signaling PathwayNetPath_16:IL4 Signaling Pathway
|
|
TGF_beta_Receptor Signaling PathwayNetPath_25:FSH Signaling Pathway
|
|
PANTHER Pathway
|
Cadherin signaling pathway
|
|
Pathway Interaction Database
|
PLK1 signaling events
|
|
FOXM1 transcription factor network
|
|
p38 signaling mediated by MAPKAP kinases
|
|
Aurora A signalinge2f_pathway:E2F transcription factor network
|
|
ATR signaling pathway
|
|
Validated targets of C-MYC transcriptional activation
|
|
ATM pathwayinsulin_pathway:Insulin Pathway
|
|
Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met)
|
|
Signaling events mediated by PTP1B
|
|
Calcineurin-regulated NFAT-dependent transcription in lymphocytes
|
|
Signaling events mediated by TCPTP
|
|
IGF1 pathway
|
|
EGF receptor (ErbB1) signaling pathway
|
|
Posttranslational regulation of adherens junction stability and dissassembly
|
|
PDGFR-beta signaling pathway
|
|
N-cadherin signaling events
|
|
Reactome
|
Cyclin B2 mediated events
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
Cyclin A:Cdk2-associated events at S phase entryR-HSA-113510:E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Polo-like kinase mediated events
|
|
Activation of ATR in response to replication stress
|
|
Cyclin E associated events during G1/S transition
|
|
G1/S-Specific Transcription
|
|
Ubiquitin Mediated Degradation of Phosphorylated Cdc25A
|
|
Cyclin A:Cdk2-associated events at S phase entryR-HSA-354192:Integrin alphaIIb beta3 signaling
|
|
Regulation of IFNG signaling
|
|
Regulation of IFNA signaling
|
|
Growth hormone receptor signaling
|
|
WikiPathways
|
Senescence and Autophagy in Cancer
|
|
MAPK Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Prostate Cancer
|
|
Integrated Breast Cancer Pathway
|
|
Integrated Cancer pathway
|
|
Mitotic G2-G2/M phases
|
|
Cell CycleWP707:DNA Damage Response
|
|
G1 to S cell cycle control
|
|
S Phase
|
|
ATM Signaling Pathway
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
Cell Cycle Checkpoints
|
|
miRNAs involved in DNA damage response
|
|
miRNA Regulation of DNA Damage ResponseWP481:Insulin Signaling
|
|
Growth hormone receptor signaling
|
|
Leptin signaling pathway
|
|
Interferon gamma signaling
|
|
Interferon alpha/beta signaling
|
|
Integrin alphaIIb beta3 signaling
|
| References |
| REF 1 | Bioorg Med Chem Lett. 2006 Apr 1;16(7):1905-8. Epub 2006 Jan 24.Synthesis of miltirone analogues as inhibitors of Cdc25 phosphatases. |
|---|
