| Drug General Information |
| Drug ID |
D0R5FH
|
| Former ID |
DIB019094
|
| Drug Name |
Quinoxaline1
|
| Synonyms |
quinoxaline1
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
|
| Formula |
C9H7N5
|
| InChI |
InChI=1S/C9H7N5/c10-8-7-9(14-13-8)12-6-4-2-1-3-5(6)11-7/h1-4H,(H3,10,12,13,14)
|
| InChIKey |
DWHVZCLBMTZRQM-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
582371, 5333485, 6711854, 11108319, 11114238, 11437952, 14720322, 15067061, 26758400, 36883279, 48317966, 76985091, 85788168, 91746526, 99302655, 103567265, 104619355, 132576526, 162023320, 162528221, 162874423, 163688436, 164780459, 172831861, 172836080, 175607463, 177748372, 178102570, 179236127, 223959984, 227610308, 241088291, 241375702, 243605574, 248594160, 252156200
|
| Target and Pathway |
| Target(s) |
Cell division protein kinase 5 |
Target Info |
Inhibitor |
[2]
|
|---|
| Cell division control protein 2 homolog |
Target Info |
Inhibitor |
[2]
|
| Glycogen synthase kinase-3 beta |
Target Info |
Inhibitor |
[2]
|
|
KEGG Pathway
|
Axon guidance
|
|
Alzheimer's disease
|
|
Cocaine addictionhsa04110:Cell cycle
|
|
Oocyte meiosis
|
|
p53 signaling pathway
|
|
Gap junction
|
|
Progesterone-mediated oocyte maturation
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Viral carcinogenesishsa04012:ErbB signaling pathway
|
|
Chemokine signaling pathway
|
|
Cell cycle
|
|
PI3K-Akt signaling pathway
|
|
Wnt signaling pathway
|
|
Hedgehog signaling pathway
|
|
Hippo signaling pathway
|
|
Focal adhesion
|
|
Signaling pathways regulating pluripotency of stem cells
|
|
T cell receptor signaling pathway
|
|
B cell receptor signaling pathway
|
|
Neurotrophin signaling pathway
|
|
Dopaminergic synapse
|
|
Insulin signaling pathway
|
|
Melanogenesis
|
|
Prolactin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Hepatitis C
|
|
Measles
|
|
Influenza A
|
|
HTLV-I infection
|
|
Pathways in cancer
|
|
Colorectal cancer
|
|
Endometrial cancer
|
|
Prostate cancer
|
|
Basal cell carcinoma
|
|
NetPath Pathway
|
EGFR1 Signaling Pathway
|
|
TCR Signaling PathwayNetPath_21:RANKL Signaling Pathway
|
|
PANTHER Pathway
|
Axon guidance mediated by semaphorinsP00004:Alzheimer disease-presenilin pathway
|
|
Angiogenesis
|
|
Cadherin signaling pathway
|
|
Hedgehog signaling pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Insulin/IGF pathway-protein kinase B signaling cascade
|
|
Interleukin signaling pathway
|
|
PDGF signaling pathway
|
|
PI3 kinase pathway
|
|
Wnt signaling pathway
|
|
Ras Pathway
|
|
CCKR signaling map ST
|
|
Pathway Interaction Database
|
Reelin signaling pathway
|
|
Glucocorticoid receptor regulatory network
|
|
Lissencephaly gene (LIS1) in neuronal migration and development
|
|
EPHA forward signaling
|
|
Trk receptor signaling mediated by the MAPK pathwayp73pathway:p73 transcription factor network
|
|
E2F transcription factor network
|
|
PLK1 signaling events
|
|
AP-1 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Retinoic acid receptors-mediated signalinglysophospholipid_pathway:LPA receptor mediated events
|
|
Degradation of beta catenin
|
|
Presenilin action in Notch and Wnt signaling
|
|
Integrin-linked kinase signaling
|
|
CDC42 signaling events
|
|
LKB1 signaling events
|
|
Canonical Wnt signaling pathway
|
|
Role of Calcineurin-dependent NFAT signaling in lymphocytes
|
|
C-MYC pathway
|
|
Regulation of Androgen receptor activity
|
|
BMP receptor signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Signaling events mediated by Stem cell factor receptor (c-Kit)
|
|
Validated transcriptional targets of deltaNp63 isoforms
|
|
Aurora A signaling
|
|
Insulin-mediated glucose transport
|
|
Class I PI3K signaling events mediated by Akt
|
|
p53 pathway
|
|
Trk receptor signaling mediated by PI3K and PLC-gamma
|
|
Reactome
|
DARPP-32 events
|
|
CRMPs in Sema3A signaling
|
|
Factors involved in megakaryocyte development and platelet productionR-HSA-110056:MAPK3 (ERK1) activation
|
|
E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Cyclin B2 mediated events
|
|
Golgi Cisternae Pericentriolar Stack Reorganization
|
|
Cdc20:Phospho-APC/C mediated degradation of Cyclin A
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
Phosphorylation of the APC/C
|
|
Phosphorylation of Emi1
|
|
Condensation of Prophase Chromosomes
|
|
MASTL Facilitates Mitotic Progression
|
|
Resolution of Sister Chromatid Cohesion
|
|
Condensation of Prometaphase Chromosomes
|
|
Regulation of PLK1 Activity at G2/M Transition
|
|
Activation of NIMA Kinases NEK9, NEK6, NEK7
|
|
Loss of Nlp from mitotic centrosomes
|
|
Recruitment of mitotic centrosome proteins and complexes
|
|
Loss of proteins required for interphase microtubule organization?from the centrosome
|
|
Recruitment of NuMA to mitotic centrosomes
|
|
Depolymerisation of the Nuclear Lamina
|
|
Anchoring of the basal body to the plasma membrane
|
|
MAPK6/MAPK4 signaling
|
|
G1/S-Specific Transcription
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
G2/M DNA replication checkpoint
|
|
Chk1/Chk2(Cds1) mediated inactivation of Cyclin B:Cdk1 complexR-HSA-195253:Degradation of beta-catenin by the destruction complex
|
|
AKT phosphorylates targets in the cytosol
|
|
Regulation of HSF1-mediated heat shock response
|
|
Disassembly of the destruction complex and recruitment of AXIN to the membrane
|
|
S33 mutants of beta-catenin aren't phosphorylated
|
|
S37 mutants of beta-catenin aren't phosphorylated
|
|
S45 mutants of beta-catenin aren't phosphorylated
|
|
T41 mutants of beta-catenin aren't phosphorylated
|
|
Degradation of GLI2 by the proteasome
|
|
Constitutive Signaling by AKT1 E17K in Cancer
|
|
WikiPathways
|
DNA Damage Response
|
|
BDNF signaling pathway
|
|
Alzheimers Disease
|
|
Opioid Signalling
|
|
Semaphorin interactions
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Nicotine Activity on Dopaminergic Neurons
|
|
miRNA Regulation of DNA Damage ResponseWP707:DNA Damage Response
|
|
G1 to S cell cycle control
|
|
TGF beta Signaling Pathway
|
|
PPAR Alpha Pathway
|
|
MAP kinase activation in TLR cascade
|
|
RAF/MAP kinase cascade
|
|
Mitotic Prophase
|
|
Mitotic Prometaphase
|
|
BMI1
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Prostate Cancer
|
|
Regulation of Microtubule Cytoskeleton
|
|
Integrated Cancer pathway
|
|
Mitotic G2-G2/M phases
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage ResponseWP710:DNA Damage Response (only ATM dependent)
|
|
Senescence and Autophagy in Cancer
|
|
Notch Signaling Pathway
|
|
Glycogen Metabolism
|
|
Insulin Signaling
|
|
Wnt Signaling Pathway
|
|
Wnt Signaling Pathway and Pluripotency
|
|
IL-6 signaling pathway
|
|
Wnt Signaling Pathway Netpath
|
|
Copper homeostasis
|
|
Focal Adhesion
|
|
Hair Follicle Development: Induction (Part 1 of 3)
|
|
Cardiac Hypertrophic Response
|
|
Degradation of beta-catenin by the destruction complex
|
|
T-Cell Receptor and Co-stimulatory Signaling
|
|
Cardiac Progenitor Differentiation
|
|
Corticotropin-releasing hormone
|
|
B Cell Receptor Signaling Pathway
|
|
IL17 signaling pathway
|
|
Neural Crest Differentiation
|
|
IL-7 Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
Leptin signaling pathway
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Androgen receptor signaling pathway
|
|
IL-5 Signaling Pathway
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 5947). |
|---|
| REF 2 | Proc Natl Acad Sci U S A. 2007 Dec 18;104(51):20523-8. Epub 2007 Dec 11.A systematic interaction map of validated kinase inhibitors with Ser/Thr kinases. |
|---|
