| Drug General Information |
| Drug ID |
D00PWQ
|
| Former ID |
DNC004072
|
| Drug Name |
KENPAULLONE
|
| Drug Type |
Small molecular drug
|
| Indication |
Discovery agent
|
Investigative |
[1]
|
|---|
| Structure |
|
Download
2D MOL
3D MOL
|
| Formula |
C16H11BrN2O
|
| InChI |
InChI=1S/C16H11BrN2O/c17-9-5-6-14-11(7-9)12-8-15(20)18-13-4-2-1-3-10(13)16(12)19-14/h1-7,19H,8H2,(H,18,20)
|
| InChIKey |
QQUXFYAWXPMDOE-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
239529, 510800, 5316928, 8036822, 8137684, 8152418, 10318973, 11111353, 11114063, 11114602, 11426650, 11447379, 14875043, 17405208, 24278507, 26752182, 26759020, 29222939, 47364999, 47365000, 47736273, 48034917, 48334285, 50104838, 50104839, 53777753, 57322006, 68533354, 77506583, 85231102, 85756472, 85787252, 90341508, 91614107, 92304234, 92764154, 99302770, 103235175, 103809703, 103905487, 104304619, 117390778, 121361459, 124633633, 124634238, 124880504, 124880505, 124880506, 125335557, 129062026
|
| Target and Pathway |
| Target(s) |
Cell division control protein 2 homolog |
Target Info |
Inhibitor |
[2]
|
|---|
| Glycogen synthase kinase-3 beta |
Target Info |
Inhibitor |
[3]
|
| Cyclin-dependent protein kinase Pfmrk |
Target Info |
Inhibitor |
[4]
|
| G2/mitotic-specific cyclin B1 |
Target Info |
Inhibitor |
[2]
|
| Cell division protein kinase 5 |
Target Info |
Inhibitor |
[3]
|
|
KEGG Pathway
|
Cell cycle
|
|
Oocyte meiosis
|
|
p53 signaling pathway
|
|
Gap junction
|
|
Progesterone-mediated oocyte maturation
|
|
Herpes simplex infection
|
|
Epstein-Barr virus infection
|
|
Viral carcinogenesishsa04012:ErbB signaling pathway
|
|
Chemokine signaling pathway
|
|
PI3K-Akt signaling pathway
|
|
Wnt signaling pathway
|
|
Hedgehog signaling pathway
|
|
Axon guidance
|
|
Hippo signaling pathway
|
|
Focal adhesion
|
|
Signaling pathways regulating pluripotency of stem cells
|
|
T cell receptor signaling pathway
|
|
B cell receptor signaling pathway
|
|
Neurotrophin signaling pathway
|
|
Dopaminergic synapse
|
|
Insulin signaling pathway
|
|
Melanogenesis
|
|
Prolactin signaling pathway
|
|
Thyroid hormone signaling pathway
|
|
Non-alcoholic fatty liver disease (NAFLD)
|
|
Alzheimer's disease
|
|
Hepatitis C
|
|
Measles
|
|
Influenza A
|
|
HTLV-I infection
|
|
Pathways in cancer
|
|
Colorectal cancer
|
|
Endometrial cancer
|
|
Prostate cancer
|
|
Basal cell carcinomahsa04068:FoxO signaling pathway
|
|
Progesterone-mediated oocyte maturationhsa04360:Axon guidance
|
|
Cocaine addiction
|
|
NetPath Pathway
|
RANKL Signaling PathwayNetPath_11:TCR Signaling PathwayNetPath_4:EGFR1 Signaling Pathway
|
|
TCR Signaling Pathway
|
|
PANTHER Pathway
|
Alzheimer disease-presenilin pathway
|
|
Angiogenesis
|
|
Cadherin signaling pathway
|
|
Hedgehog signaling pathway
|
|
Heterotrimeric G-protein signaling pathway-Gi alpha and Gs alpha mediated pathway
|
|
Insulin/IGF pathway-protein kinase B signaling cascade
|
|
Interleukin signaling pathway
|
|
PDGF signaling pathway
|
|
PI3 kinase pathway
|
|
Wnt signaling pathway
|
|
Ras Pathway
|
|
CCKR signaling map STP00059:p53 pathwayP00007:Axon guidance mediated by semaphorins
|
|
Pathway Interaction Database
|
p73 transcription factor network
|
|
E2F transcription factor network
|
|
PLK1 signaling events
|
|
AP-1 transcription factor network
|
|
FOXM1 transcription factor network
|
|
Retinoic acid receptors-mediated signalinglysophospholipid_pathway:LPA receptor mediated events
|
|
Degradation of beta catenin
|
|
Reelin signaling pathway
|
|
Presenilin action in Notch and Wnt signaling
|
|
Integrin-linked kinase signaling
|
|
CDC42 signaling events
|
|
LKB1 signaling events
|
|
Canonical Wnt signaling pathway
|
|
Role of Calcineurin-dependent NFAT signaling in lymphocytes
|
|
Glucocorticoid receptor regulatory network
|
|
C-MYC pathway
|
|
Regulation of Androgen receptor activity
|
|
BMP receptor signaling
|
|
Hedgehog signaling events mediated by Gli proteins
|
|
Signaling events mediated by Stem cell factor receptor (c-Kit)
|
|
Validated transcriptional targets of deltaNp63 isoforms
|
|
Aurora A signaling
|
|
Insulin-mediated glucose transport
|
|
Class I PI3K signaling events mediated by Akt
|
|
p53 pathway
|
|
Trk receptor signaling mediated by PI3K and PLC-gammap73pathway:p73 transcription factor network
|
|
Validated targets of C-MYC transcriptional activation
|
|
FoxO family signaling
|
|
Direct p53 effectors
|
|
C-MYB transcription factor networkreelinpathway:Reelin signaling pathway
|
|
Lissencephaly gene (LIS1) in neuronal migration and development
|
|
EPHA forward signaling
|
|
Trk receptor signaling mediated by the MAPK pathway
|
|
Reactome
|
MAPK3 (ERK1) activation
|
|
E2F mediated regulation of DNA replication
|
|
G0 and Early G1
|
|
Cyclin B2 mediated events
|
|
Golgi Cisternae Pericentriolar Stack Reorganization
|
|
Cdc20:Phospho-APC/C mediated degradation of Cyclin A
|
|
Regulation of APC/C activators between G1/S and early anaphase
|
|
Phosphorylation of the APC/C
|
|
Phosphorylation of Emi1
|
|
Condensation of Prophase Chromosomes
|
|
MASTL Facilitates Mitotic Progression
|
|
Resolution of Sister Chromatid Cohesion
|
|
Condensation of Prometaphase Chromosomes
|
|
Regulation of PLK1 Activity at G2/M Transition
|
|
Activation of NIMA Kinases NEK9, NEK6, NEK7
|
|
Loss of Nlp from mitotic centrosomes
|
|
Recruitment of mitotic centrosome proteins and complexes
|
|
Loss of proteins required for interphase microtubule organization?from the centrosome
|
|
Recruitment of NuMA to mitotic centrosomes
|
|
Depolymerisation of the Nuclear Lamina
|
|
Anchoring of the basal body to the plasma membrane
|
|
MAPK6/MAPK4 signaling
|
|
G1/S-Specific Transcription
|
|
Cyclin A/B1 associated events during G2/M transition
|
|
G2/M DNA replication checkpoint
|
|
Chk1/Chk2(Cds1) mediated inactivation of Cyclin B:Cdk1 complexR-HSA-195253:Degradation of beta-catenin by the destruction complex
|
|
AKT phosphorylates targets in the cytosol
|
|
Regulation of HSF1-mediated heat shock response
|
|
CRMPs in Sema3A signaling
|
|
Disassembly of the destruction complex and recruitment of AXIN to the membrane
|
|
S33 mutants of beta-catenin aren't phosphorylated
|
|
S37 mutants of beta-catenin aren't phosphorylated
|
|
S45 mutants of beta-catenin aren't phosphorylated
|
|
T41 mutants of beta-catenin aren't phosphorylated
|
|
Degradation of GLI2 by the proteasome
|
|
Constitutive Signaling by AKT1 E17K in CancerR-HSA-156711:Polo-like kinase mediated events
|
|
Chk1/Chk2(Cds1) mediated inactivation of Cyclin B:Cdk1 complexR-HSA-180024:DARPP-32 events
|
|
Factors involved in megakaryocyte development and platelet production
|
|
WikiPathways
|
DNA Damage Response
|
|
G1 to S cell cycle control
|
|
TGF beta Signaling Pathway
|
|
PPAR Alpha Pathway
|
|
MAP kinase activation in TLR cascade
|
|
RAF/MAP kinase cascade
|
|
Mitotic Prophase
|
|
Mitotic Prometaphase
|
|
BMI1
|
|
ATM Signaling Pathway
|
|
Retinoblastoma (RB) in Cancer
|
|
Spinal Cord Injury
|
|
Prostate Cancer
|
|
Regulation of Microtubule Cytoskeleton
|
|
Integrated Cancer pathway
|
|
Mitotic G2-G2/M phases
|
|
Mitotic G1-G1/S phases
|
|
Cell Cycle
|
|
APC/C-mediated degradation of cell cycle proteins
|
|
Cell Cycle Checkpoints
|
|
miRNA Regulation of DNA Damage ResponseWP710:DNA Damage Response (only ATM dependent)
|
|
Senescence and Autophagy in Cancer
|
|
Notch Signaling Pathway
|
|
Glycogen Metabolism
|
|
Insulin Signaling
|
|
Wnt Signaling Pathway
|
|
Wnt Signaling Pathway and Pluripotency
|
|
IL-6 signaling pathway
|
|
Wnt Signaling Pathway Netpath
|
|
Copper homeostasis
|
|
Focal Adhesion
|
|
Hair Follicle Development: Induction (Part 1 of 3)
|
|
Cardiac Hypertrophic Response
|
|
Degradation of beta-catenin by the destruction complex
|
|
T-Cell Receptor and Co-stimulatory Signaling
|
|
Cardiac Progenitor Differentiation
|
|
BDNF signaling pathway
|
|
Corticotropin-releasing hormone
|
|
B Cell Receptor Signaling Pathway
|
|
IL17 signaling pathway
|
|
Neural Crest Differentiation
|
|
Alzheimers Disease
|
|
IL-7 Signaling Pathway
|
|
TWEAK Signaling Pathway
|
|
Leptin signaling pathway
|
|
Semaphorin interactions
|
|
MicroRNAs in cardiomyocyte hypertrophy
|
|
Androgen receptor signaling pathway
|
|
IL-5 Signaling PathwayWP707:DNA Damage Response
|
|
miRNA Regulation of DNA Damage Response
|
|
AMPK SignalingWP707:DNA Damage Response
|
|
Opioid Signalling
|
|
Factors involved in megakaryocyte development and platelet production
|
|
Nicotine Activity on Dopaminergic Neurons
|
| References |
| REF 1 | (http://www.guidetopharmacology.org/) Nucleic Acids Res. 2015 Oct 12. pii: gkv1037. The IUPHAR/BPS Guide to PHARMACOLOGY in 2016: towards curated quantitative interactions between 1300 protein targets and 6000 ligands. (Ligand id: 6000). |
|---|
| REF 2 | Eur J Med Chem. 2010 Sep;45(9):4316-30. Epub 2010 Jun 30.Discovery of novel CDK1 inhibitors by combining pharmacophore modeling, QSAR analysis and in silico screening followed by in vitro bioassay. |
|---|
| REF 3 | Bioorg Med Chem Lett. 2004 Jan 19;14(2):413-6.1-Azakenpaullone is a selective inhibitor of glycogen synthase kinase-3 beta. |
|---|
| REF 4 | J Med Chem. 2004 Oct 21;47(22):5418-26.A three-dimensional in silico pharmacophore model for inhibition of Plasmodium falciparum cyclin-dependent kinases and discovery of different classes of novel Pfmrk specific inhibitors. |
|---|
